C13H16N2O3S2 — CID 22550140
2-methyl-6-pyrrolidin-1-ylsulfonyl-4H-1,4-benzothiazin-3-one (PubChem CID 22550140) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-methyl-6-pyrrolidin-1-ylsulfonyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-methyl-6-pyrrolidin-1-ylsulfonyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 22550140 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-methyl-6-pyrrolidin-1-ylsulfonyl-4H-1,4-benzothiazin-3-one |
| SMILES | CC1Sc2ccc(S(=O)(=O)N3CCCC3)cc2NC1=O |
| InChI | InChI=1S/C13H16N2O3S2/c1-9-13(16)14-11-8-10(4-5-12(11)19-9)20(17,18)15-6-2-3-7-15/h4-5,8-9H,2-3,6-7H2,1H3,(H,14,16) |
| InChIKey | CCQDLWQIWPWBFY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |