C21H24N2O3S2 — CID 22550164
6-(4-benzylpiperidin-1-yl)sulfonyl-2-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 22550164) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)sulfonyl-2-methyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(4-benzylpiperidin-1-yl)sulfonyl-2-methyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 22550164 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)sulfonyl-2-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | CC1Sc2ccc(S(=O)(=O)N3CCC(Cc4ccccc4)CC3)cc2NC1=O |
| InChI | InChI=1S/C21H24N2O3S2/c1-15-21(24)22-19-14-18(7-8-20(19)27-15)28(25,26)23-11-9-17(10-12-23)13-16-5-3-2-4-6-16/h2-8,14-15,17H,9-13H2,1H3,(H,22,24) |
| InChIKey | IMFCEZKOPAMJKI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |