C23H31N3O4S2 — CID 92692642
N-[2-(cyclohexen-1-yl)ethyl]-1-[[(2S)-2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl]sulfonyl]piperidine-4-carboxamide (PubChem CID 92692642) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-[[(2S)-2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl]sulfonyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[[(2S)-2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl]sulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92692642 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-[[(2S)-2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl]sulfonyl]piperidine-4-carboxamide |
| SMILES | C[C@@H]1Sc2ccc(S(=O)(=O)N3CCC(C(=O)NCCC4=CCCCC4)CC3)cc2NC1=O |
| InChI | InChI=1S/C23H31N3O4S2/c1-16-22(27)25-20-15-19(7-8-21(20)31-16)32(29,30)26-13-10-18(11-14-26)23(28)24-12-9-17-5-3-2-4-6-17/h5,7-8,15-16,18H,2-4,6,9-14H2,1H3,(H,24,28)(H,25,27)/t16-/m0/s1 |
| InChIKey | WOOYSWBZSFZFJO-INIZCTEOSA-N |
| XLogP | 3.53 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|