C17H30N2O4S — CID 110335401
N-[2-(cyclohexen-1-yl)ethyl]-1-(2-methoxyethylsulfonyl)piperidine-4-carboxamide (PubChem CID 110335401) has the molecular formula C17H30N2O4S and a molecular weight of 358.50 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-(2-methoxyethylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(2-methoxyethylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110335401 |
| Molecular Formula | C17H30N2O4S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(2-methoxyethylsulfonyl)piperidine-4-carboxamide |
| SMILES | COCCS(=O)(=O)N1CCC(C(=O)NCCC2=CCCCC2)CC1 |
| InChI | InChI=1S/C17H30N2O4S/c1-23-13-14-24(21,22)19-11-8-16(9-12-19)17(20)18-10-7-15-5-3-2-4-6-15/h5,16H,2-4,6-14H2,1H3,(H,18,20) |
| InChIKey | WJGXKMKMTXTVQI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|