C14H23NOS — CID 110849147
N-[2-(cyclohexen-1-yl)ethyl]thiane-4-carboxamide (PubChem CID 110849147) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]thiane-4-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]thiane-4-carboxamide |
|---|---|
| PubChem CID | 110849147 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]thiane-4-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CCSCC1 |
| InChI | InChI=1S/C14H23NOS/c16-14(13-7-10-17-11-8-13)15-9-6-12-4-2-1-3-5-12/h4,13H,1-3,5-11H2,(H,15,16) |
| InChIKey | SSTITLMFFHYFDA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|