C24H34N2O2 — CID 109146362
1-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[(2-methylphenyl)methyl]cyclohexane-1,4-dicarboxamide (PubChem CID 109146362) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[(2-methylphenyl)methyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[(2-methylphenyl)methyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109146362 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[(2-methylphenyl)methyl]cyclohexane-1,4-dicarboxamide |
| SMILES | Cc1ccccc1CNC(=O)C1CCC(C(=O)NCCC2=CCCCC2)CC1 |
| InChI | InChI=1S/C24H34N2O2/c1-18-7-5-6-10-22(18)17-26-24(28)21-13-11-20(12-14-21)23(27)25-16-15-19-8-3-2-4-9-19/h5-8,10,20-21H,2-4,9,11-17H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | MSAYLDDJNMVAEF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|