C24H35N5O3S — CID 92871168
1-[1-[(2R)-butan-2-yl]benzotriazol-5-yl]sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]piperidine-4-carboxamide (PubChem CID 92871168) has the molecular formula C24H35N5O3S and a molecular weight of 473.64 g/mol. Its IUPAC name is 1-[1-[(2R)-butan-2-yl]benzotriazol-5-yl]sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[(2R)-butan-2-yl]benzotriazol-5-yl]sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92871168 |
| Molecular Formula | C24H35N5O3S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 1-[1-[(2R)-butan-2-yl]benzotriazol-5-yl]sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]piperidine-4-carboxamide |
| SMILES | CC[C@@H](C)n1nnc2cc(S(=O)(=O)N3CCC(C(=O)NCCC4=CCCCC4)CC3)ccc21 |
| InChI | InChI=1S/C24H35N5O3S/c1-3-18(2)29-23-10-9-21(17-22(23)26-27-29)33(31,32)28-15-12-20(13-16-28)24(30)25-14-11-19-7-5-4-6-8-19/h7,9-10,17-18,20H,3-6,8,11-16H2,1-2H3,(H,25,30)/t18-/m1/s1 |
| InChIKey | YKIXNGKOHRPDCA-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|