C23H33N5O4S — CID 92890179
(3R)-N-[2-(cyclohexen-1-yl)ethyl]-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpiperidine-3-carboxamide (PubChem CID 92890179) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is (3R)-N-[2-(cyclohexen-1-yl)ethyl]-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(cyclohexen-1-yl)ethyl]-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 92890179 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (3R)-N-[2-(cyclohexen-1-yl)ethyl]-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpiperidine-3-carboxamide |
| SMILES | COCCn1nnc2cc(S(=O)(=O)N3CCC[C@@H](C(=O)NCCC4=CCCCC4)C3)ccc21 |
| InChI | InChI=1S/C23H33N5O4S/c1-32-15-14-28-22-10-9-20(16-21(22)25-26-28)33(30,31)27-13-5-8-19(17-27)23(29)24-12-11-18-6-3-2-4-7-18/h6,9-10,16,19H,2-5,7-8,11-15,17H2,1H3,(H,24,29)/t19-/m1/s1 |
| InChIKey | JHXHFNPUPJYYJQ-LJQANCHMSA-N |
| XLogP | 2.49 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|