C18H27N5O4S — CID 50787443
N-butyl-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 50787443) has the molecular formula C18H27N5O4S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-butyl-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-butyl-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 50787443 |
| Molecular Formula | C18H27N5O4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-butyl-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN1S(=O)(=O)c1ccc2c(c1)nnn2CCOC |
| InChI | InChI=1S/C18H27N5O4S/c1-3-4-9-19-18(24)17-6-5-10-23(17)28(25,26)14-7-8-16-15(13-14)20-21-22(16)11-12-27-2/h7-8,13,17H,3-6,9-12H2,1-2H3,(H,19,24) |
| InChIKey | OFMBKEWPEFBVTL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|