C20H25N5O5S — CID 46330238
N-(furan-2-ylmethyl)-1-[1-(3-methoxypropyl)benzotriazol-5-yl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 46330238) has the molecular formula C20H25N5O5S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[1-(3-methoxypropyl)benzotriazol-5-yl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-[1-(3-methoxypropyl)benzotriazol-5-yl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46330238 |
| Molecular Formula | C20H25N5O5S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[1-(3-methoxypropyl)benzotriazol-5-yl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | COCCCn1nnc2cc(S(=O)(=O)N3CCCC3C(=O)NCc3ccco3)ccc21 |
| InChI | InChI=1S/C20H25N5O5S/c1-29-11-4-9-24-18-8-7-16(13-17(18)22-23-24)31(27,28)25-10-2-6-19(25)20(26)21-14-15-5-3-12-30-15/h3,5,7-8,12-13,19H,2,4,6,9-11,14H2,1H3,(H,21,26) |
| InChIKey | SIYDJAQLZPSXLH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|