C22H27N5O4S — CID 92890289
(2R)-N-benzyl-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpiperidine-2-carboxamide (PubChem CID 92890289) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is (2R)-N-benzyl-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpiperidine-2-carboxamide.
| Compound Name | (2R)-N-benzyl-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 92890289 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (2R)-N-benzyl-1-[1-(2-methoxyethyl)benzotriazol-5-yl]sulfonylpiperidine-2-carboxamide |
| SMILES | COCCn1nnc2cc(S(=O)(=O)N3CCCC[C@@H]3C(=O)NCc3ccccc3)ccc21 |
| InChI | InChI=1S/C22H27N5O4S/c1-31-14-13-26-20-11-10-18(15-19(20)24-25-26)32(29,30)27-12-6-5-9-21(27)22(28)23-16-17-7-3-2-4-8-17/h2-4,7-8,10-11,15,21H,5-6,9,12-14,16H2,1H3,(H,23,28)/t21-/m1/s1 |
| InChIKey | MCQDMCRHHYSWJK-OAQYLSRUSA-N |
| XLogP | 1.94 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |