C23H33N5O3S — CID 53077652
N-[2-(cyclohexen-1-yl)ethyl]-4-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)butanamide (PubChem CID 53077652) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)butanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)butanamide |
|---|---|
| PubChem CID | 53077652 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)butanamide |
| SMILES | O=C(CCCn1nnc2cc(S(=O)(=O)N3CCCCC3)ccc21)NCCC1=CCCCC1 |
| InChI | InChI=1S/C23H33N5O3S/c29-23(24-14-13-19-8-3-1-4-9-19)10-7-17-28-22-12-11-20(18-21(22)25-26-28)32(30,31)27-15-5-2-6-16-27/h8,11-12,18H,1-7,9-10,13-17H2,(H,24,29) |
| InChIKey | RPBUZQQLNJAJQE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|