C19H30N6O3S — CID 53077605
N-[2-(dimethylamino)ethyl]-4-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)butanamide (PubChem CID 53077605) has the molecular formula C19H30N6O3S and a molecular weight of 422.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)butanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)butanamide |
|---|---|
| PubChem CID | 53077605 |
| Molecular Formula | C19H30N6O3S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(5-piperidin-1-ylsulfonylbenzotriazol-1-yl)butanamide |
| SMILES | CN(C)CCNC(=O)CCCn1nnc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C19H30N6O3S/c1-23(2)14-10-20-19(26)7-6-13-25-18-9-8-16(15-17(18)21-22-25)29(27,28)24-11-4-3-5-12-24/h8-9,15H,3-7,10-14H2,1-2H3,(H,20,26) |
| InChIKey | SZRQGMXDPVJQEN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |