C20H29N5O3S — CID 53077726
N-[2-(cyclohexen-1-yl)ethyl]-4-[5-(dimethylsulfamoyl)benzotriazol-1-yl]butanamide (PubChem CID 53077726) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[5-(dimethylsulfamoyl)benzotriazol-1-yl]butanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[5-(dimethylsulfamoyl)benzotriazol-1-yl]butanamide |
|---|---|
| PubChem CID | 53077726 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[5-(dimethylsulfamoyl)benzotriazol-1-yl]butanamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)nnn2CCCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H29N5O3S/c1-24(2)29(27,28)17-10-11-19-18(15-17)22-23-25(19)14-6-9-20(26)21-13-12-16-7-4-3-5-8-16/h7,10-11,15H,3-6,8-9,12-14H2,1-2H3,(H,21,26) |
| InChIKey | WGIMZIFUQNVFEQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|