C17H25N5O4S — CID 97043859
4-[5-(dimethylsulfamoyl)benzotriazol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]butanamide (PubChem CID 97043859) has the molecular formula C17H25N5O4S and a molecular weight of 395.49 g/mol. Its IUPAC name is 4-[5-(dimethylsulfamoyl)benzotriazol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]butanamide.
| Compound Name | 4-[5-(dimethylsulfamoyl)benzotriazol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 97043859 |
| Molecular Formula | C17H25N5O4S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-[5-(dimethylsulfamoyl)benzotriazol-1-yl]-N-[[(2S)-oxolan-2-yl]methyl]butanamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)nnn2CCCC(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H25N5O4S/c1-21(2)27(24,25)14-7-8-16-15(11-14)19-20-22(16)9-3-6-17(23)18-12-13-5-4-10-26-13/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H,18,23)/t13-/m0/s1 |
| InChIKey | IKRXNZDXHGGGQB-ZDUSSCGKSA-N |
| XLogP | 0.76 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |