C16H21FN2O6S — CID 7976445
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7976445) has the molecular formula C16H21FN2O6S and a molecular weight of 388.42 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7976445 |
| Molecular Formula | C16H21FN2O6S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(F)c(C(=O)OCC(=O)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C16H21FN2O6S/c1-19(2)26(22,23)12-5-6-14(17)13(8-12)16(21)25-10-15(20)18-9-11-4-3-7-24-11/h5-6,8,11H,3-4,7,9-10H2,1-2H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | BFTSVOIUBANACT-LLVKDONJSA-N |
| XLogP | 0.53 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |