C14H15ClN2O6 — CID 8604071
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 5-chloro-2-nitrobenzoate (PubChem CID 8604071) has the molecular formula C14H15ClN2O6 and a molecular weight of 342.74 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 8604071 |
| Molecular Formula | C14H15ClN2O6 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 5-chloro-2-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1[N+](=O)[O-])NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H15ClN2O6/c15-9-3-4-12(17(20)21)11(6-9)14(19)23-8-13(18)16-7-10-2-1-5-22-10/h3-4,6,10H,1-2,5,7-8H2,(H,16,18)/t10-/m0/s1 |
| InChIKey | CPKYUQKCGBCHLO-JTQLQIEISA-N |
| XLogP | 1.70 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|