About oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate
oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate (PubChem CID 60643030) has the molecular formula C12H12ClNO5
and a molecular weight of 285.68 g/mol. Its IUPAC name is oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate |
| PubChem CID | 60643030 |
| Molecular Formula | C12H12ClNO5 |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate |
| SMILES | O=C(OCC1CCCO1)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12ClNO5/c13-8-3-4-11(14(16)17)10(6-8)12(15)19-7-9-2-1-5-18-9/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | QACLHMGGHNHTCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate?
The IUPAC name of oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate (CID 60643030) is oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate.
What is the SMILES notation for oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate?
The canonical SMILES for oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate is O=C(OCC1CCCO1)c1cc(Cl)ccc1[N+](=O)[O-].
What is the InChIKey of oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate?
The InChIKey is QACLHMGGHNHTCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO5/c13-8-3-4-11(14(16)17)10(6-8)12(15)19-7-9-2-1-5-18-9/h3-4,6,9H,1-2,5,7H2.
What are the key properties of oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate?
oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate has a molecular weight of 285.68 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl 5-chloro-2-nitrobenzoate is sourced from PubChem (CID 60643030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).