C20H21ClN2O6 — CID 2653769
[2-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-chloro-2-nitrobenzoate (PubChem CID 2653769) has the molecular formula C20H21ClN2O6 and a molecular weight of 420.85 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-chloro-2-nitrobenzoate.
| Compound Name | [2-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 2653769 |
| Molecular Formula | C20H21ClN2O6 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [2-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-chloro-2-nitrobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2ccc(Cl)cc2[N+](=O)[O-])c(C)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H21ClN2O6/c1-12-8-17(13(2)22(12)10-15-4-3-7-28-15)19(24)11-29-20(25)16-6-5-14(21)9-18(16)23(26)27/h5-6,8-9,15H,3-4,7,10-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | HEZFAYOUWPVBAQ-OAHLLOKOSA-N |
| XLogP | 3.89 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|