C21H24N2O7 — CID 2124785
[2-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-methoxy-3-nitrobenzoate (PubChem CID 2124785) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-methoxy-3-nitrobenzoate.
| Compound Name | [2-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 2124785 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [2-[2,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 4-methoxy-3-nitrobenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)c2cc(C)n(C[C@H]3CCCO3)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N2O7/c1-13-9-17(14(2)22(13)11-16-5-4-8-29-16)19(24)12-30-21(25)15-6-7-20(28-3)18(10-15)23(26)27/h6-7,9-10,16H,4-5,8,11-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | GYIDJENPLXFNSV-MRXNPFEDSA-N |
| XLogP | 3.24 |
| TPSA | 109.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|