C21H19F3N2O6S — CID 41144173
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate (PubChem CID 41144173) has the molecular formula C21H19F3N2O6S and a molecular weight of 484.45 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 41144173 |
| Molecular Formula | C21H19F3N2O6S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NC[C@H]1CCCO1 |
| InChI | InChI=1S/C21H19F3N2O6S/c22-21(23,24)13-7-8-18(16(10-13)26(29)30)33-17-6-2-1-5-15(17)20(28)32-12-19(27)25-11-14-4-3-9-31-14/h1-2,5-8,10,14H,3-4,9,11-12H2,(H,25,27)/t14-/m1/s1 |
| InChIKey | PGZXTQQHSNWOEB-CQSZACIVSA-N |
| XLogP | 4.22 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|