C15H11F3N2O4S — CID 154836083
N-methoxy-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzamide (PubChem CID 154836083) has the molecular formula C15H11F3N2O4S and a molecular weight of 372.32 g/mol. Its IUPAC name is N-methoxy-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzamide.
| Compound Name | N-methoxy-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 154836083 |
| Molecular Formula | C15H11F3N2O4S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | N-methoxy-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzamide |
| SMILES | CONC(=O)c1ccccc1Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11F3N2O4S/c1-24-19-14(21)10-4-2-3-5-12(10)25-13-7-6-9(15(16,17)18)8-11(13)20(22)23/h2-8H,1H3,(H,19,21) |
| InChIKey | XLSFMZGTYQBCBP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|