C21H15ClF3N3O2S2 — CID 2818599
1-(2-chloro-4-methylphenyl)-3-[2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylphenyl]thiourea (PubChem CID 2818599) has the molecular formula C21H15ClF3N3O2S2 and a molecular weight of 497.95 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-[2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylphenyl]thiourea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-[2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylphenyl]thiourea |
|---|---|
| PubChem CID | 2818599 |
| Molecular Formula | C21H15ClF3N3O2S2 |
| Molecular Weight | 497.95 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-[2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylphenyl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccccc2Sc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C21H15ClF3N3O2S2/c1-12-6-8-15(14(22)10-12)26-20(31)27-16-4-2-3-5-18(16)32-19-9-7-13(21(23,24)25)11-17(19)28(29)30/h2-11H,1H3,(H2,26,27,31) |
| InChIKey | BSJATHQDVUUVME-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.95 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|