C18H14F3N3O6S — CID 2530631
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate (PubChem CID 2530631) has the molecular formula C18H14F3N3O6S and a molecular weight of 457.39 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 2530631 |
| Molecular Formula | C18H14F3N3O6S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-])C(=O)NC(N)=O |
| InChI | InChI=1S/C18H14F3N3O6S/c1-9(15(25)23-17(22)27)30-16(26)11-4-2-3-5-13(11)31-14-7-6-10(18(19,20)21)8-12(14)24(28)29/h2-9H,1H3,(H3,22,23,25,27)/t9-/m1/s1 |
| InChIKey | XSHCJHHKKKJVTJ-SECBINFHSA-N |
| XLogP | 3.51 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|