C26H18N2O6S — CID 126185615
benzhydryl 2-(2,4-dinitrophenyl)sulfanylbenzoate (PubChem CID 126185615) has the molecular formula C26H18N2O6S and a molecular weight of 486.51 g/mol. Its IUPAC name is benzhydryl 2-(2,4-dinitrophenyl)sulfanylbenzoate.
| Compound Name | benzhydryl 2-(2,4-dinitrophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 126185615 |
| Molecular Formula | C26H18N2O6S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | benzhydryl 2-(2,4-dinitrophenyl)sulfanylbenzoate |
| SMILES | O=C(OC(c1ccccc1)c1ccccc1)c1ccccc1Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H18N2O6S/c29-26(34-25(18-9-3-1-4-10-18)19-11-5-2-6-12-19)21-13-7-8-14-23(21)35-24-16-15-20(27(30)31)17-22(24)28(32)33/h1-17,25H |
| InChIKey | QOQUOKYJESSQOU-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|