C23H16N2O9S — CID 126189774
[2-(4-acetyloxyphenyl)-2-oxoethyl] 2-(2,4-dinitrophenyl)sulfanylbenzoate (PubChem CID 126189774) has the molecular formula C23H16N2O9S and a molecular weight of 496.45 g/mol. Its IUPAC name is [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-(2,4-dinitrophenyl)sulfanylbenzoate.
| Compound Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-(2,4-dinitrophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 126189774 |
| Molecular Formula | C23H16N2O9S |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 2-(2,4-dinitrophenyl)sulfanylbenzoate |
| SMILES | CC(=O)Oc1ccc(C(=O)COC(=O)c2ccccc2Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H16N2O9S/c1-14(26)34-17-9-6-15(7-10-17)20(27)13-33-23(28)18-4-2-3-5-21(18)35-22-11-8-16(24(29)30)12-19(22)25(31)32/h2-12H,13H2,1H3 |
| InChIKey | URYUARFLJVKCCB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 155.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|