C23H16N2O10 — CID 126188724
[2-(4-acetyloxyphenyl)-2-oxoethyl] 3-(2,4-dinitrophenoxy)benzoate (PubChem CID 126188724) has the molecular formula C23H16N2O10 and a molecular weight of 480.39 g/mol. Its IUPAC name is [2-(4-acetyloxyphenyl)-2-oxoethyl] 3-(2,4-dinitrophenoxy)benzoate.
| Compound Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 3-(2,4-dinitrophenoxy)benzoate |
|---|---|
| PubChem CID | 126188724 |
| Molecular Formula | C23H16N2O10 |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 3-(2,4-dinitrophenoxy)benzoate |
| SMILES | CC(=O)Oc1ccc(C(=O)COC(=O)c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H16N2O10/c1-14(26)34-18-8-5-15(6-9-18)21(27)13-33-23(28)16-3-2-4-19(11-16)35-22-10-7-17(24(29)30)12-20(22)25(31)32/h2-12H,13H2,1H3 |
| InChIKey | LFAAIPUKFUJZJR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 165.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|