C15H9BrN2O7 — CID 1422233
[2-(4-bromophenyl)-2-oxoethyl] 2,4-dinitrobenzoate (PubChem CID 1422233) has the molecular formula C15H9BrN2O7 and a molecular weight of 409.15 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2,4-dinitrobenzoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2,4-dinitrobenzoate |
|---|---|
| PubChem CID | 1422233 |
| Molecular Formula | C15H9BrN2O7 |
| Molecular Weight | 409.15 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2,4-dinitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H9BrN2O7/c16-10-3-1-9(2-4-10)14(19)8-25-15(20)12-6-5-11(17(21)22)7-13(12)18(23)24/h1-7H,8H2 |
| InChIKey | KSYQJWVVNLMXQS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.15 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|