C21H16BrN5O6 — CID 46501789
[(2E)-2-(4-bromophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl] 2-aminobenzoate (PubChem CID 46501789) has the molecular formula C21H16BrN5O6 and a molecular weight of 514.29 g/mol. Its IUPAC name is [(2E)-2-(4-bromophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl] 2-aminobenzoate.
| Compound Name | [(2E)-2-(4-bromophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl] 2-aminobenzoate |
|---|---|
| PubChem CID | 46501789 |
| Molecular Formula | C21H16BrN5O6 |
| Molecular Weight | 514.29 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | [(2E)-2-(4-bromophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl] 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OC/C(=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H16BrN5O6/c22-14-7-5-13(6-8-14)19(12-33-21(28)16-3-1-2-4-17(16)23)25-24-18-10-9-15(26(29)30)11-20(18)27(31)32/h1-11,24H,12,23H2/b25-19- |
| InChIKey | KXEXDBGVUWGFRD-PLRJNAJWSA-N |
| XLogP | 4.52 |
| TPSA | 162.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|