C19H16ClN6O4+ — CID 5169736
1-[2-(4-chlorophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl]pyridin-1-ium-4-amine (PubChem CID 5169736) has the molecular formula C19H16ClN6O4+ and a molecular weight of 427.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl]pyridin-1-ium-4-amine.
| Compound Name | 1-[2-(4-chlorophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl]pyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 5169736 |
| Molecular Formula | C19H16ClN6O4+ |
| Molecular Weight | 427.83 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl]pyridin-1-ium-4-amine |
| SMILES | Nc1cc[n+](CC(=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H15ClN6O4/c20-14-3-1-13(2-4-14)18(12-24-9-7-15(21)8-10-24)23-22-17-6-5-16(25(27)28)11-19(17)26(29)30/h1-11,21-22H,12H2/p+1 |
| InChIKey | OFPCTGWJYHGHLD-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|