C24H23BrN6O8 — CID 131665374
1-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl]-N-(2-hydroxyethyl)pyridin-1-ium-4-carboximidate;hydrobromide (PubChem CID 131665374) has the molecular formula C24H23BrN6O8 and a molecular weight of 603.39 g/mol. Its IUPAC name is 1-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl]-N-(2-hydroxyethyl)pyridin-1-ium-4-carboximidate;hydrobromide.
| Compound Name | 1-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl]-N-(2-hydroxyethyl)pyridin-1-ium-4-carboximidate;hydrobromide |
|---|---|
| PubChem CID | 131665374 |
| Molecular Formula | C24H23BrN6O8 |
| Molecular Weight | 603.39 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | 1-[(2Z)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[(2,4-dinitrophenyl)hydrazinylidene]ethyl]-N-(2-hydroxyethyl)pyridin-1-ium-4-carboximidate;hydrobromide |
| SMILES | Br.O=[N+]([O-])c1ccc(N/N=C(\C[n+]2ccc(/C([O-])=N/CCO)cc2)c2ccc3c(c2)OCCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H22N6O8.BrH/c31-10-7-25-24(32)16-5-8-28(9-6-16)15-20(17-1-4-22-23(13-17)38-12-11-37-22)27-26-19-3-2-18(29(33)34)14-21(19)30(35)36;/h1-6,8-9,13-14,26,31H,7,10-12,15H2;1H/b27-20+; |
| InChIKey | UZMLWBACKNRMPQ-PQAWYCKWSA-N |
| XLogP | 1.76 |
| TPSA | 188.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|