C21H19ClN5O4+ — CID 6090370
N-[(Z)-[1-(4-chlorophenyl)-2-(2,4-dimethylpyridin-1-ium-1-yl)ethylidene]amino]-2,4-dinitroaniline (PubChem CID 6090370) has the molecular formula C21H19ClN5O4+ and a molecular weight of 440.87 g/mol. Its IUPAC name is N-[(Z)-[1-(4-chlorophenyl)-2-(2,4-dimethylpyridin-1-ium-1-yl)ethylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[1-(4-chlorophenyl)-2-(2,4-dimethylpyridin-1-ium-1-yl)ethylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6090370 |
| Molecular Formula | C21H19ClN5O4+ |
| Molecular Weight | 440.87 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[(Z)-[1-(4-chlorophenyl)-2-(2,4-dimethylpyridin-1-ium-1-yl)ethylidene]amino]-2,4-dinitroaniline |
| SMILES | Cc1cc[n+](C/C(=N\Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C21H19ClN5O4/c1-14-9-10-25(15(2)11-14)13-20(16-3-5-17(22)6-4-16)24-23-19-8-7-18(26(28)29)12-21(19)27(30)31/h3-12,23H,13H2,1-2H3/q+1/b24-20+ |
| InChIKey | DBPJUKLLFBXBHQ-HIXSDJFHSA-N |
| XLogP | 4.58 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|