C23H18BrN6O6+ — CID 126960733
2,4-dinitro-N-[(Z)-[1-(3-nitrophenyl)-2-quinolin-1-ium-1-ylethylidene]amino]aniline;hydrobromide (PubChem CID 126960733) has the molecular formula C23H18BrN6O6+ and a molecular weight of 554.34 g/mol. Its IUPAC name is 2,4-dinitro-N-[(Z)-[1-(3-nitrophenyl)-2-quinolin-1-ium-1-ylethylidene]amino]aniline;hydrobromide.
| Compound Name | 2,4-dinitro-N-[(Z)-[1-(3-nitrophenyl)-2-quinolin-1-ium-1-ylethylidene]amino]aniline;hydrobromide |
|---|---|
| PubChem CID | 126960733 |
| Molecular Formula | C23H18BrN6O6+ |
| Molecular Weight | 554.34 g/mol |
| Exact Mass | 553.05 |
| IUPAC Name | 2,4-dinitro-N-[(Z)-[1-(3-nitrophenyl)-2-quinolin-1-ium-1-ylethylidene]amino]aniline;hydrobromide |
| SMILES | Br.O=[N+]([O-])c1cccc(/C(C[n+]2cccc3ccccc32)=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17N6O6.BrH/c30-27(31)18-8-3-6-17(13-18)21(15-26-12-4-7-16-5-1-2-9-22(16)26)25-24-20-11-10-19(28(32)33)14-23(20)29(34)35;/h1-14,24H,15H2;1H/q+1;/b25-21+; |
| InChIKey | CZROXEAUXQQWHK-JMFMGIQESA-N |
| XLogP | 4.95 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|