C20H17N6O6+ — CID 98550245
N-[(E)-[2-(3-methylpyridin-1-ium-1-yl)-1-(4-nitrophenyl)ethylidene]amino]-2,4-dinitroaniline (PubChem CID 98550245) has the molecular formula C20H17N6O6+ and a molecular weight of 437.39 g/mol. Its IUPAC name is N-[(E)-[2-(3-methylpyridin-1-ium-1-yl)-1-(4-nitrophenyl)ethylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[2-(3-methylpyridin-1-ium-1-yl)-1-(4-nitrophenyl)ethylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 98550245 |
| Molecular Formula | C20H17N6O6+ |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[(E)-[2-(3-methylpyridin-1-ium-1-yl)-1-(4-nitrophenyl)ethylidene]amino]-2,4-dinitroaniline |
| SMILES | Cc1ccc[n+](C/C(=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C20H17N6O6/c1-14-3-2-10-23(12-14)13-19(15-4-6-16(7-5-15)24(27)28)22-21-18-9-8-17(25(29)30)11-20(18)26(31)32/h2-12,21H,13H2,1H3/q+1/b22-19- |
| InChIKey | KUDZHCHKEMEYQN-QOCHGBHMSA-N |
| XLogP | 3.52 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|