C20H17ClN5O4+ — CID 45045292
N-[(E)-[1-(4-chlorophenyl)-2-(4-methylpyridin-1-ium-1-yl)ethylidene]amino]-2,4-dinitroaniline (PubChem CID 45045292) has the molecular formula C20H17ClN5O4+ and a molecular weight of 426.84 g/mol. Its IUPAC name is N-[(E)-[1-(4-chlorophenyl)-2-(4-methylpyridin-1-ium-1-yl)ethylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(E)-[1-(4-chlorophenyl)-2-(4-methylpyridin-1-ium-1-yl)ethylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 45045292 |
| Molecular Formula | C20H17ClN5O4+ |
| Molecular Weight | 426.84 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-[(E)-[1-(4-chlorophenyl)-2-(4-methylpyridin-1-ium-1-yl)ethylidene]amino]-2,4-dinitroaniline |
| SMILES | Cc1cc[n+](C/C(=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H17ClN5O4/c1-14-8-10-24(11-9-14)13-19(15-2-4-16(21)5-3-15)23-22-18-7-6-17(25(27)28)12-20(18)26(29)30/h2-12,22H,13H2,1H3/q+1/b23-19- |
| InChIKey | UYKUHFTZRKMAQA-NMWGTECJSA-N |
| XLogP | 4.27 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.84 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|