C16H11ClN4O7 — CID 6108032
(2E)-4-(4-chlorophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]-4-oxobutanoic acid (PubChem CID 6108032) has the molecular formula C16H11ClN4O7 and a molecular weight of 406.74 g/mol. Its IUPAC name is (2E)-4-(4-chlorophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]-4-oxobutanoic acid.
| Compound Name | (2E)-4-(4-chlorophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6108032 |
| Molecular Formula | C16H11ClN4O7 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | (2E)-4-(4-chlorophenyl)-2-[(2,4-dinitrophenyl)hydrazinylidene]-4-oxobutanoic acid |
| SMILES | O=C(O)/C(CC(=O)c1ccc(Cl)cc1)=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClN4O7/c17-10-3-1-9(2-4-10)15(22)8-13(16(23)24)19-18-12-6-5-11(20(25)26)7-14(12)21(27)28/h1-7,18H,8H2,(H,23,24)/b19-13+ |
| InChIKey | QXLXMMFVSQRUMS-CPNJWEJPSA-N |
| XLogP | 3.28 |
| TPSA | 165.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|