C16H13BrN4O6 — CID 21203663
N-[(Z)-[2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylidene]amino]-2,4-dinitroaniline (PubChem CID 21203663) has the molecular formula C16H13BrN4O6 and a molecular weight of 437.21 g/mol. Its IUPAC name is N-[(Z)-[2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylidene]amino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-[2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylidene]amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 21203663 |
| Molecular Formula | C16H13BrN4O6 |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | N-[(Z)-[2-bromo-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylidene]amino]-2,4-dinitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C(\CBr)c2ccc3c(c2)OCCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13BrN4O6/c17-9-13(10-1-4-15-16(7-10)27-6-5-26-15)19-18-12-3-2-11(20(22)23)8-14(12)21(24)25/h1-4,7-8,18H,5-6,9H2/b19-13+ |
| InChIKey | HEEZCPBMHJEHFQ-CPNJWEJPSA-N |
| XLogP | 3.49 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|