C25H23N5O7 — CID 92652605
[(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] 5-anilino-5-oxopentanoate (PubChem CID 92652605) has the molecular formula C25H23N5O7 and a molecular weight of 505.49 g/mol. Its IUPAC name is [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] 5-anilino-5-oxopentanoate.
| Compound Name | [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] 5-anilino-5-oxopentanoate |
|---|---|
| PubChem CID | 92652605 |
| Molecular Formula | C25H23N5O7 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | [(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-2-phenylethyl] 5-anilino-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)OC/C(=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C25H23N5O7/c31-24(26-19-10-5-2-6-11-19)12-7-13-25(32)37-17-22(18-8-3-1-4-9-18)28-27-21-15-14-20(29(33)34)16-23(21)30(35)36/h1-6,8-11,14-16,27H,7,12-13,17H2,(H,26,31)/b28-22+ |
| InChIKey | PSOZROHNDYYTBH-XAYXJRQQSA-N |
| XLogP | 4.67 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|