About (2,4-dinitrophenyl)sulfanyl benzoate
(2,4-dinitrophenyl)sulfanyl benzoate (PubChem CID 154123636) has the molecular formula C13H8N2O6S
and a molecular weight of 320.28 g/mol. Its IUPAC name is (2,4-dinitrophenyl)sulfanyl benzoate.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl)sulfanyl benzoate |
| PubChem CID | 154123636 |
| Molecular Formula | C13H8N2O6S |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | (2,4-dinitrophenyl)sulfanyl benzoate |
| SMILES | O=C(OSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C13H8N2O6S/c16-13(9-4-2-1-3-5-9)21-22-12-7-6-10(14(17)18)8-11(12)15(19)20/h1-8H |
| InChIKey | HNCTWQDKPCFKDI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl)sulfanyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl)sulfanyl benzoate?
The IUPAC name of (2,4-dinitrophenyl)sulfanyl benzoate (CID 154123636) is (2,4-dinitrophenyl)sulfanyl benzoate.
What is the SMILES notation for (2,4-dinitrophenyl)sulfanyl benzoate?
The canonical SMILES for (2,4-dinitrophenyl)sulfanyl benzoate is O=C(OSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1.
What is the InChIKey of (2,4-dinitrophenyl)sulfanyl benzoate?
The InChIKey is HNCTWQDKPCFKDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O6S/c16-13(9-4-2-1-3-5-9)21-22-12-7-6-10(14(17)18)8-11(12)15(19)20/h1-8H.
What are the key properties of (2,4-dinitrophenyl)sulfanyl benzoate?
(2,4-dinitrophenyl)sulfanyl benzoate has a molecular weight of 320.28 g/mol, XLogP of 3.37, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl)sulfanyl benzoate is sourced from PubChem (CID 154123636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).