C20H13N3O4S — CID 13356213
N-[2-(2,4-dinitrophenyl)sulfanylethynyl]-N-phenylaniline (PubChem CID 13356213) has the molecular formula C20H13N3O4S and a molecular weight of 391.41 g/mol. Its IUPAC name is N-[2-(2,4-dinitrophenyl)sulfanylethynyl]-N-phenylaniline.
| Compound Name | N-[2-(2,4-dinitrophenyl)sulfanylethynyl]-N-phenylaniline |
|---|---|
| PubChem CID | 13356213 |
| Molecular Formula | C20H13N3O4S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | N-[2-(2,4-dinitrophenyl)sulfanylethynyl]-N-phenylaniline |
| SMILES | O=[N+]([O-])c1ccc(SC#CN(c2ccccc2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H13N3O4S/c24-22(25)18-11-12-20(19(15-18)23(26)27)28-14-13-21(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-12,15H |
| InChIKey | KNVRJWUPVIUWBU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|