C14H13N3O4S — CID 2189365
N-[2-(2,4-dinitrophenyl)sulfanylethyl]aniline (PubChem CID 2189365) has the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. Its IUPAC name is N-[2-(2,4-dinitrophenyl)sulfanylethyl]aniline.
| Compound Name | N-[2-(2,4-dinitrophenyl)sulfanylethyl]aniline |
|---|---|
| PubChem CID | 2189365 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-[2-(2,4-dinitrophenyl)sulfanylethyl]aniline |
| SMILES | O=[N+]([O-])c1ccc(SCCNc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N3O4S/c18-16(19)12-6-7-14(13(10-12)17(20)21)22-9-8-15-11-4-2-1-3-5-11/h1-7,10,15H,8-9H2 |
| InChIKey | PPHXZERWROISJB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|