C14H14N4O7 — CID 121004377
N-ethylaniline;2,4,6-trinitrophenol (PubChem CID 121004377) has the molecular formula C14H14N4O7 and a molecular weight of 350.29 g/mol. Its IUPAC name is N-ethylaniline;2,4,6-trinitrophenol.
| Compound Name | N-ethylaniline;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 121004377 |
| Molecular Formula | C14H14N4O7 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-ethylaniline;2,4,6-trinitrophenol |
| SMILES | CCNc1ccccc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H11N.C6H3N3O7/c1-2-9-8-6-4-3-5-7-8;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-7,9H,2H2,1H3;1-2,10H |
| InChIKey | SWTWECKQRGFGQW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|