C17H20N8O14 — CID 131876243
N'-ethyl-N-methylethane-1,2-diamine;bis(2,4,6-trinitrophenol) (PubChem CID 131876243) has the molecular formula C17H20N8O14 and a molecular weight of 560.39 g/mol. Its IUPAC name is N'-ethyl-N-methylethane-1,2-diamine;bis(2,4,6-trinitrophenol).
| Compound Name | N'-ethyl-N-methylethane-1,2-diamine;bis(2,4,6-trinitrophenol) |
|---|---|
| PubChem CID | 131876243 |
| Molecular Formula | C17H20N8O14 |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | N'-ethyl-N-methylethane-1,2-diamine;bis(2,4,6-trinitrophenol) |
| SMILES | CCNCCNC.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/2C6H3N3O7.C5H14N2/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;1-3-7-5-4-6-2/h2*1-2,10H;6-7H,3-5H2,1-2H3 |
| InChIKey | LFOCQQYTMLRUDN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 323.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|