C22H39N4O7+ — CID 88714512
tetrabutylazanium;2,4,6-trinitrophenol (PubChem CID 88714512) has the molecular formula C22H39N4O7+ and a molecular weight of 471.58 g/mol. Its IUPAC name is tetrabutylazanium;2,4,6-trinitrophenol.
| Compound Name | tetrabutylazanium;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 88714512 |
| Molecular Formula | C22H39N4O7+ |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | tetrabutylazanium;2,4,6-trinitrophenol |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H36N.C6H3N3O7/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h5-16H2,1-4H3;1-2,10H/q+1; |
| InChIKey | HATVYMZYGANAFO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|