C26H47N4O7+ — CID 87131013
tetrakis(3-methylbutyl)azanium;2,4,6-trinitrophenol (PubChem CID 87131013) has the molecular formula C26H47N4O7+ and a molecular weight of 527.68 g/mol. Its IUPAC name is tetrakis(3-methylbutyl)azanium;2,4,6-trinitrophenol.
| Compound Name | tetrakis(3-methylbutyl)azanium;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 87131013 |
| Molecular Formula | C26H47N4O7+ |
| Molecular Weight | 527.68 g/mol |
| Exact Mass | 527.34 |
| IUPAC Name | tetrakis(3-methylbutyl)azanium;2,4,6-trinitrophenol |
| SMILES | CC(C)CC[N+](CCC(C)C)(CCC(C)C)CCC(C)C.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H44N.C6H3N3O7/c1-17(2)9-13-21(14-10-18(3)4,15-11-19(5)6)16-12-20(7)8;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h17-20H,9-16H2,1-8H3;1-2,10H/q+1; |
| InChIKey | GGUDGHPYRRVSNO-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.68 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|