C9H12N2O7 — CID 87637947
ethane-1,2-diol;2-methyl-4,6-dinitrophenol (PubChem CID 87637947) has the molecular formula C9H12N2O7 and a molecular weight of 260.20 g/mol. Its IUPAC name is ethane-1,2-diol;2-methyl-4,6-dinitrophenol.
| Compound Name | ethane-1,2-diol;2-methyl-4,6-dinitrophenol |
|---|---|
| PubChem CID | 87637947 |
| Molecular Formula | C9H12N2O7 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | ethane-1,2-diol;2-methyl-4,6-dinitrophenol |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O.OCCO |
| InChI | InChI=1S/C7H6N2O5.C2H6O2/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14;3-1-2-4/h2-3,10H,1H3;3-4H,1-2H2 |
| InChIKey | KUAXOKRGFAFKNR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|