C13H14N4O5 — CID 87772567
2-methyl-4,6-dinitrophenol;phenylhydrazine (PubChem CID 87772567) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-methyl-4,6-dinitrophenol;phenylhydrazine.
| Compound Name | 2-methyl-4,6-dinitrophenol;phenylhydrazine |
|---|---|
| PubChem CID | 87772567 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-methyl-4,6-dinitrophenol;phenylhydrazine |
| SMILES | Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O.NNc1ccccc1 |
| InChI | InChI=1S/C7H6N2O5.C6H8N2/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14;7-8-6-4-2-1-3-5-6/h2-3,10H,1H3;1-5,8H,7H2 |
| InChIKey | AEBJMWAJTNOAEO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|