C19H23N3O5S2 — CID 88757319
cyclopentane;2-methyl-4,6-dinitrophenol;phenyl carbamodithioate (PubChem CID 88757319) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is cyclopentane;2-methyl-4,6-dinitrophenol;phenyl carbamodithioate.
| Compound Name | cyclopentane;2-methyl-4,6-dinitrophenol;phenyl carbamodithioate |
|---|---|
| PubChem CID | 88757319 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | cyclopentane;2-methyl-4,6-dinitrophenol;phenyl carbamodithioate |
| SMILES | C1CCCC1.Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O.NC(=S)Sc1ccccc1 |
| InChI | InChI=1S/C7H6N2O5.C7H7NS2.C5H10/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14;8-7(9)10-6-4-2-1-3-5-6;1-2-4-5-3-1/h2-3,10H,1H3;1-5H,(H2,8,9);1-5H2 |
| InChIKey | HRHFZOFPEFARMI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 132.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|