C24H18N3O7PS — CID 87917711
2,4,6-trinitrophenol;triphenyl(sulfanylidene)-λ5-phosphane (PubChem CID 87917711) has the molecular formula C24H18N3O7PS and a molecular weight of 523.46 g/mol. Its IUPAC name is 2,4,6-trinitrophenol;triphenyl(sulfanylidene)-λ5-phosphane.
| Compound Name | 2,4,6-trinitrophenol;triphenyl(sulfanylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 87917711 |
| Molecular Formula | C24H18N3O7PS |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 2,4,6-trinitrophenol;triphenyl(sulfanylidene)-λ5-phosphane |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.S=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15PS.C6H3N3O7/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-15H;1-2,10H |
| InChIKey | DYXCLAKYUMLUSL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|