C11H9N5O7 — CID 54605967
pyridin-2-amine;2,4,6-trinitrophenol (PubChem CID 54605967) has the molecular formula C11H9N5O7 and a molecular weight of 323.22 g/mol. Its IUPAC name is pyridin-2-amine;2,4,6-trinitrophenol.
| Compound Name | pyridin-2-amine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 54605967 |
| Molecular Formula | C11H9N5O7 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | pyridin-2-amine;2,4,6-trinitrophenol |
| SMILES | Nc1ccccn1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C5H6N2/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;6-5-3-1-2-4-7-5/h1-2,10H;1-4H,(H2,6,7) |
| InChIKey | NIFUADPRWMMPAN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 188.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|